C20H23BrN2O2S — CID 139071908
(3aR,6S,6aR)-5-(benzenesulfonyl)-1-(4-bromophenyl)-6-ethyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole (PubChem CID 139071908) has the molecular formula C20H23BrN2O2S and a molecular weight of 435.39 g/mol. Its IUPAC name is (3aR,6S,6aR)-5-(benzenesulfonyl)-1-(4-bromophenyl)-6-ethyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole.
| Compound Name | (3aR,6S,6aR)-5-(benzenesulfonyl)-1-(4-bromophenyl)-6-ethyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole |
|---|---|
| PubChem CID | 139071908 |
| Molecular Formula | C20H23BrN2O2S |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | (3aR,6S,6aR)-5-(benzenesulfonyl)-1-(4-bromophenyl)-6-ethyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrole |
| SMILES | CC[C@H]1[C@H]2[C@H](CCN2c2ccc(Br)cc2)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23BrN2O2S/c1-2-19-20-15(12-13-22(20)17-10-8-16(21)9-11-17)14-23(19)26(24,25)18-6-4-3-5-7-18/h3-11,15,19-20H,2,12-14H2,1H3/t15-,19+,20-/m1/s1 |
| InChIKey | USKYFTNXDJBTGP-UIAACRFSSA-N |
| XLogP | 4.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |