C23H26N2O8S — CID 132504864
dipropan-2-yl 1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)aziridine-2,2-dicarboxylate (PubChem CID 132504864) has the molecular formula C23H26N2O8S and a molecular weight of 490.53 g/mol. Its IUPAC name is dipropan-2-yl 1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)aziridine-2,2-dicarboxylate.
| Compound Name | dipropan-2-yl 1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)aziridine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 132504864 |
| Molecular Formula | C23H26N2O8S |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | dipropan-2-yl 1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)aziridine-2,2-dicarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2C(c3ccc([N+](=O)[O-])cc3)C2(C(=O)OC(C)C)C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C23H26N2O8S/c1-14(2)32-21(26)23(22(27)33-15(3)4)20(17-8-10-18(11-9-17)25(28)29)24(23)34(30,31)19-12-6-16(5)7-13-19/h6-15,20H,1-5H3 |
| InChIKey | ZKCBARSOKCZGNG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|