C15H16O4 — CID 177477129
ethyl 3-ethenyl-5-oxo-2-phenyloxolane-3-carboxylate (PubChem CID 177477129) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is ethyl 3-ethenyl-5-oxo-2-phenyloxolane-3-carboxylate.
| Compound Name | ethyl 3-ethenyl-5-oxo-2-phenyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 177477129 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | ethyl 3-ethenyl-5-oxo-2-phenyloxolane-3-carboxylate |
| SMILES | C=CC1(C(=O)OCC)CC(=O)OC1c1ccccc1 |
| InChI | InChI=1S/C15H16O4/c1-3-15(14(17)18-4-2)10-12(16)19-13(15)11-8-6-5-7-9-11/h3,5-9,13H,1,4,10H2,2H3 |
| InChIKey | RCKNJRNAKFJJPB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|