C18H20O3 — CID 57341381
ethyl 2-oxo-6-phenyl-1-prop-2-enylcyclohex-3-ene-1-carboxylate (PubChem CID 57341381) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is ethyl 2-oxo-6-phenyl-1-prop-2-enylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 2-oxo-6-phenyl-1-prop-2-enylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 57341381 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | ethyl 2-oxo-6-phenyl-1-prop-2-enylcyclohex-3-ene-1-carboxylate |
| SMILES | C=CCC1(C(=O)OCC)C(=O)C=CCC1c1ccccc1 |
| InChI | InChI=1S/C18H20O3/c1-3-13-18(17(20)21-4-2)15(11-8-12-16(18)19)14-9-6-5-7-10-14/h3,5-10,12,15H,1,4,11,13H2,2H3 |
| InChIKey | OBLOMTBHQGDWJD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|