C13H14O4 — CID 14399422
ethyl (2R,3S)-5-oxo-2-phenyloxolane-3-carboxylate (PubChem CID 14399422) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is ethyl (2R,3S)-5-oxo-2-phenyloxolane-3-carboxylate.
| Compound Name | ethyl (2R,3S)-5-oxo-2-phenyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 14399422 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | ethyl (2R,3S)-5-oxo-2-phenyloxolane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC(=O)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H14O4/c1-2-16-13(15)10-8-11(14)17-12(10)9-6-4-3-5-7-9/h3-7,10,12H,2,8H2,1H3/t10-,12-/m0/s1 |
| InChIKey | DKPAIIGTJBOURV-JQWIXIFHSA-N |
| XLogP | 1.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |