C21H34O4Si — CID 166448975
ethyl 2-[(2R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-phenyloxan-2-yl]acetate (PubChem CID 166448975) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is ethyl 2-[(2R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-phenyloxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-phenyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 166448975 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | ethyl 2-[(2R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-phenyloxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C21H34O4Si/c1-7-23-20(22)15-17-13-18(25-26(5,6)21(2,3)4)14-19(24-17)16-11-9-8-10-12-16/h8-12,17-19H,7,13-15H2,1-6H3/t17-,18-,19-/m1/s1 |
| InChIKey | GVQCBRCFVDNFLJ-GUDVDZBRSA-N |
| XLogP | 5.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|