C20H34O4Si — CID 166448933
tert-butyl-[[(2S,4S,6R)-4-(methoxymethoxy)-6-phenyloxan-2-yl]methoxy]-dimethylsilane (PubChem CID 166448933) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is tert-butyl-[[(2S,4S,6R)-4-(methoxymethoxy)-6-phenyloxan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,4S,6R)-4-(methoxymethoxy)-6-phenyloxan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 166448933 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | tert-butyl-[[(2S,4S,6R)-4-(methoxymethoxy)-6-phenyloxan-2-yl]methoxy]-dimethylsilane |
| SMILES | COCO[C@@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C20H34O4Si/c1-20(2,3)25(5,6)23-14-18-12-17(22-15-21-4)13-19(24-18)16-10-8-7-9-11-16/h7-11,17-19H,12-15H2,1-6H3/t17-,18+,19-/m1/s1 |
| InChIKey | BSHZRGYJUHPZFH-CEXWTWQISA-N |
| XLogP | 4.92 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|