C31H57NO5Si3 — CID 177391057
[(3aR,5R,6R,7R,7aR)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 177391057) has the molecular formula C31H57NO5Si3 and a molecular weight of 608.06 g/mol. Its IUPAC name is [(3aR,5R,6R,7R,7aR)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,5R,6R,7R,7aR)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 177391057 |
| Molecular Formula | C31H57NO5Si3 |
| Molecular Weight | 608.06 g/mol |
| Exact Mass | 607.35 |
| IUPAC Name | [(3aR,5R,6R,7R,7aR)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2-phenyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H]2OC(c3ccccc3)=N[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H57NO5Si3/c1-29(2,3)38(10,11)33-21-23-25(36-39(12,13)30(4,5)6)26(37-40(14,15)31(7,8)9)24-28(34-23)35-27(32-24)22-19-17-16-18-20-22/h16-20,23-26,28H,21H2,1-15H3/t23-,24-,25-,26-,28-/m1/s1 |
| InChIKey | BFHFDYKIFOSSRX-RDVFURSVSA-N |
| XLogP | 8.36 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.06 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|