C24H52O5Si3 — CID 14408406
[(1R,3R,4S,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,7-dioxabicyclo[4.1.0]heptan-3-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 14408406) has the molecular formula C24H52O5Si3 and a molecular weight of 504.93 g/mol. Its IUPAC name is [(1R,3R,4S,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,7-dioxabicyclo[4.1.0]heptan-3-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3R,4S,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,7-dioxabicyclo[4.1.0]heptan-3-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 14408406 |
| Molecular Formula | C24H52O5Si3 |
| Molecular Weight | 504.93 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | [(1R,3R,4S,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,7-dioxabicyclo[4.1.0]heptan-3-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H]2O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H52O5Si3/c1-22(2,3)30(10,11)25-16-17-18(28-31(12,13)23(4,5)6)19(20-21(26-17)27-20)29-32(14,15)24(7,8)9/h17-21H,16H2,1-15H3/t17-,18+,19+,20-,21+/m1/s1 |
| InChIKey | UKQSMOCKDYHOTE-IFLJBQAJSA-N |
| XLogP | 6.91 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.93 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|