C28H56N2O4Si3 — CID 44633293
6-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyridin-2-amine (PubChem CID 44633293) has the molecular formula C28H56N2O4Si3 and a molecular weight of 569.02 g/mol. Its IUPAC name is 6-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyridin-2-amine.
| Compound Name | 6-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 44633293 |
| Molecular Formula | C28H56N2O4Si3 |
| Molecular Weight | 569.02 g/mol |
| Exact Mass | 568.35 |
| IUPAC Name | 6-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyridin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](c2cccc(N)n2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56N2O4Si3/c1-26(2,3)35(10,11)31-19-21-24(33-36(12,13)27(4,5)6)25(34-37(14,15)28(7,8)9)23(32-21)20-17-16-18-22(29)30-20/h16-18,21,23-25H,19H2,1-15H3,(H2,29,30)/t21-,23+,24-,25+/m1/s1 |
| InChIKey | WHMLCHUKCNTMPP-WUEDSLEZSA-N |
| XLogP | 7.91 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.02 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|