C30H60N2O4Si3 — CID 53474641
5-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N,N-dimethylpyridin-2-amine (PubChem CID 53474641) has the molecular formula C30H60N2O4Si3 and a molecular weight of 597.08 g/mol. Its IUPAC name is 5-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N,N-dimethylpyridin-2-amine.
| Compound Name | 5-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 53474641 |
| Molecular Formula | C30H60N2O4Si3 |
| Molecular Weight | 597.08 g/mol |
| Exact Mass | 596.39 |
| IUPAC Name | 5-[(2S,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1ccc([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)cn1 |
| InChI | InChI=1S/C30H60N2O4Si3/c1-28(2,3)37(12,13)33-21-23-26(35-38(14,15)29(4,5)6)27(36-39(16,17)30(7,8)9)25(34-23)22-18-19-24(31-20-22)32(10)11/h18-20,23,25-27H,21H2,1-17H3/t23-,25+,26-,27+/m1/s1 |
| InChIKey | XQHXXVWGAOKEIH-ZJHRHMSFSA-N |
| XLogP | 8.39 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.08 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|