C40H51N3O6Si — CID 44519228
N'-[5-[(2S,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-2-pyridinyl]-N,N-dimethylmethanimidamide (PubChem CID 44519228) has the molecular formula C40H51N3O6Si and a molecular weight of 697.95 g/mol. Its IUPAC name is N'-[5-[(2S,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-2-pyridinyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[5-[(2S,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-2-pyridinyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 44519228 |
| Molecular Formula | C40H51N3O6Si |
| Molecular Weight | 697.95 g/mol |
| Exact Mass | 697.35 |
| IUPAC Name | N'-[5-[(2S,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-2-pyridinyl]-N,N-dimethylmethanimidamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](c3ccc(/N=C/N(C)C)nc3)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H51N3O6Si/c1-39(2,3)50(8,9)49-38-36(44)34(48-37(38)28-15-24-35(41-25-28)42-27-43(4)5)26-47-40(29-13-11-10-12-14-29,30-16-20-32(45-6)21-17-30)31-18-22-33(46-7)23-19-31/h10-25,27,34,36-38,44H,26H2,1-9H3/b42-27+/t34-,36-,37+,38-/m1/s1 |
| InChIKey | KZNXDXHKKQNYNM-ACBDFAECSA-N |
| XLogP | 7.52 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.95 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|