C37H44N4O7Si — CID 140856538
3-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoxolan-2-yl]-6H-imidazo[4,5-d]pyridazin-7-one (PubChem CID 140856538) has the molecular formula C37H44N4O7Si and a molecular weight of 684.87 g/mol. Its IUPAC name is 3-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoxolan-2-yl]-6H-imidazo[4,5-d]pyridazin-7-one.
| Compound Name | 3-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoxolan-2-yl]-6H-imidazo[4,5-d]pyridazin-7-one |
|---|---|
| PubChem CID | 140856538 |
| Molecular Formula | C37H44N4O7Si |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.30 |
| IUPAC Name | 3-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoxolan-2-yl]-6H-imidazo[4,5-d]pyridazin-7-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]ncc43)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H44N4O7Si/c1-36(2,3)49(6,7)48-33-30(47-35(32(33)42)41-23-38-31-29(41)21-39-40-34(31)43)22-46-37(24-11-9-8-10-12-24,25-13-17-27(44-4)18-14-25)26-15-19-28(45-5)20-16-26/h8-21,23,30,32-33,35,42H,22H2,1-7H3,(H,40,43)/t30-,32-,33-,35-/m1/s1 |
| InChIKey | GPWGCGIUGVAZPR-NHASGABXSA-N |
| XLogP | 5.79 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|