C25H40N2O5Si2 — CID 101345446
(11R,13R,14R,15S)-14-[tert-butyl(dimethyl)silyl]oxy-13-[[tert-butyl(dimethyl)silyl]oxymethyl]-12,16-dioxa-2,10-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7-tetraen-9-one (PubChem CID 101345446) has the molecular formula C25H40N2O5Si2 and a molecular weight of 504.78 g/mol. Its IUPAC name is (11R,13R,14R,15S)-14-[tert-butyl(dimethyl)silyl]oxy-13-[[tert-butyl(dimethyl)silyl]oxymethyl]-12,16-dioxa-2,10-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7-tetraen-9-one.
| Compound Name | (11R,13R,14R,15S)-14-[tert-butyl(dimethyl)silyl]oxy-13-[[tert-butyl(dimethyl)silyl]oxymethyl]-12,16-dioxa-2,10-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7-tetraen-9-one |
|---|---|
| PubChem CID | 101345446 |
| Molecular Formula | C25H40N2O5Si2 |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | (11R,13R,14R,15S)-14-[tert-butyl(dimethyl)silyl]oxy-13-[[tert-butyl(dimethyl)silyl]oxymethyl]-12,16-dioxa-2,10-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7-tetraen-9-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H]2[C@@H](Oc3nc4ccccc4c(=O)n32)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40N2O5Si2/c1-24(2,3)33(7,8)29-15-18-19(32-34(9,10)25(4,5)6)20-22(30-18)27-21(28)16-13-11-12-14-17(16)26-23(27)31-20/h11-14,18-20,22H,15H2,1-10H3/t18-,19-,20+,22-/m1/s1 |
| InChIKey | XQFCNCYHBSCABB-XWSHUIEDSA-N |
| XLogP | 5.47 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|