C22H40N2O5Si2 — CID 10983531
(2R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-11-methyl-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one (PubChem CID 10983531) has the molecular formula C22H40N2O5Si2 and a molecular weight of 468.74 g/mol. Its IUPAC name is (2R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-11-methyl-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one.
| Compound Name | (2R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-11-methyl-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
|---|---|
| PubChem CID | 10983531 |
| Molecular Formula | C22H40N2O5Si2 |
| Molecular Weight | 468.74 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | (2R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-11-methyl-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
| SMILES | Cc1cn2c(nc1=O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]12 |
| InChI | InChI=1S/C22H40N2O5Si2/c1-14-12-24-19-17(28-20(24)23-18(14)25)16(29-31(10,11)22(5,6)7)15(27-19)13-26-30(8,9)21(2,3)4/h12,15-17,19H,13H2,1-11H3/t15-,16-,17+,19-/m1/s1 |
| InChIKey | PMFFKXCOYPLOJF-VXIBKDFQSA-N |
| XLogP | 4.62 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.74 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|