C18H18N2O8S — CID 11729512
[(2R,4R,5S,6S)-11-methyl-5-methylsulfonyloxy-10-oxo-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl benzoate (PubChem CID 11729512) has the molecular formula C18H18N2O8S and a molecular weight of 422.42 g/mol. Its IUPAC name is [(2R,4R,5S,6S)-11-methyl-5-methylsulfonyloxy-10-oxo-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl benzoate.
| Compound Name | [(2R,4R,5S,6S)-11-methyl-5-methylsulfonyloxy-10-oxo-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 11729512 |
| Molecular Formula | C18H18N2O8S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | [(2R,4R,5S,6S)-11-methyl-5-methylsulfonyloxy-10-oxo-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-4-yl]methyl benzoate |
| SMILES | Cc1cn2c(nc1=O)O[C@H]1[C@@H](OS(C)(=O)=O)[C@@H](COC(=O)c3ccccc3)O[C@H]12 |
| InChI | InChI=1S/C18H18N2O8S/c1-10-8-20-16-14(27-18(20)19-15(10)21)13(28-29(2,23)24)12(26-16)9-25-17(22)11-6-4-3-5-7-11/h3-8,12-14,16H,9H2,1-2H3/t12-,13+,14+,16-/m1/s1 |
| InChIKey | HKZNQYAEZXSBFI-ORIJERBGSA-N |
| XLogP | 0.41 |
| TPSA | 123.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|