C24H22N2O7 — CID 144735082
[(3aR,4R,6R,6aR)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-phenylbenzoate (PubChem CID 144735082) has the molecular formula C24H22N2O7 and a molecular weight of 450.45 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-phenylbenzoate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 144735082 |
| Molecular Formula | C24H22N2O7 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-phenylbenzoate |
| SMILES | Cc1cn([C@@H]2O[C@H](COC(=O)c3ccc(-c4ccccc4)cc3)[C@H]3OCO[C@H]32)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H22N2O7/c1-14-11-26(24(29)25-21(14)27)22-20-19(31-13-32-20)18(33-22)12-30-23(28)17-9-7-16(8-10-17)15-5-3-2-4-6-15/h2-11,18-20,22H,12-13H2,1H3,(H,25,27,29)/t18-,19-,20-,22-/m1/s1 |
| InChIKey | ZXKMNTREOCIYPK-NXLVEIQXSA-N |
| XLogP | 2.01 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |