C26H26N2O6 — CID 123741047
[4-ethenoxy-3-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-phenylbenzoate (PubChem CID 123741047) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is [4-ethenoxy-3-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-phenylbenzoate.
| Compound Name | [4-ethenoxy-3-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 123741047 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [4-ethenoxy-3-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-phenylbenzoate |
| SMILES | C=COC1C(C)C(COC(=O)c2ccc(-c3ccccc3)cc2)OC1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H26N2O6/c1-4-32-22-17(3)21(34-24(22)28-14-16(2)23(29)27-26(28)31)15-33-25(30)20-12-10-19(11-13-20)18-8-6-5-7-9-18/h4-14,17,21-22,24H,1,15H2,2-3H3,(H,27,29,31) |
| InChIKey | RNCLCEKIUVBBGJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|