C20H22N2O5 — CID 100995648
[(2S,4R,5S)-4-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-methylideneoxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 100995648) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is [(2S,4R,5S)-4-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-methylideneoxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2S,4R,5S)-4-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-methylideneoxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 100995648 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [(2S,4R,5S)-4-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-methylideneoxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | C=C1[C@@H](C)[C@@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-11-5-7-15(8-6-11)19(24)26-10-16-13(3)14(4)18(27-16)22-9-12(2)17(23)21-20(22)25/h5-9,14,16,18H,3,10H2,1-2,4H3,(H,21,23,25)/t14-,16-,18+/m1/s1 |
| InChIKey | ZTSVOYQDPLAFEX-KYJSFNMBSA-N |
| XLogP | 2.10 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|