C32H26N2O9 — CID 18458126
[3,4-dibenzoyloxy-5-(5-ethenyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 18458126) has the molecular formula C32H26N2O9 and a molecular weight of 582.57 g/mol. Its IUPAC name is [3,4-dibenzoyloxy-5-(5-ethenyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [3,4-dibenzoyloxy-5-(5-ethenyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 18458126 |
| Molecular Formula | C32H26N2O9 |
| Molecular Weight | 582.57 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | [3,4-dibenzoyloxy-5-(5-ethenyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | C=Cc1cn(C2OC(COC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C2OC(=O)c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C32H26N2O9/c1-2-20-18-34(32(39)33-27(20)35)28-26(43-31(38)23-16-10-5-11-17-23)25(42-30(37)22-14-8-4-9-15-22)24(41-28)19-40-29(36)21-12-6-3-7-13-21/h2-18,24-26,28H,1,19H2,(H,33,35,39) |
| InChIKey | OALPSQWCGPUWSI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|