C37H30N2O10 — CID 118205082
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[5-(4-methoxyphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate (PubChem CID 118205082) has the molecular formula C37H30N2O10 and a molecular weight of 662.65 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[5-(4-methoxyphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[5-(4-methoxyphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 118205082 |
| Molecular Formula | C37H30N2O10 |
| Molecular Weight | 662.65 g/mol |
| Exact Mass | 662.19 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[5-(4-methoxyphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate |
| SMILES | COc1ccc(-c2cn([C@@H]3O[C@H](COC(=O)c4ccccc4)[C@@H](OC(=O)c4ccccc4)[C@H]3OC(=O)c3ccccc3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C37H30N2O10/c1-45-27-19-17-23(18-20-27)28-21-39(37(44)38-32(28)40)33-31(49-36(43)26-15-9-4-10-16-26)30(48-35(42)25-13-7-3-8-14-25)29(47-33)22-46-34(41)24-11-5-2-6-12-24/h2-21,29-31,33H,22H2,1H3,(H,38,40,44)/t29-,30-,31-,33-/m1/s1 |
| InChIKey | VWBUOSBCYGYOLX-WTGZKXAYSA-N |
| XLogP | 4.42 |
| TPSA | 152.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|