C36H36N4O9 — CID 15031093
[(2R,3R,4S,5S)-3,4-dibenzoyloxy-5-[5-[(4-methylpiperazin-1-yl)methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate (PubChem CID 15031093) has the molecular formula C36H36N4O9 and a molecular weight of 668.70 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4-dibenzoyloxy-5-[5-[(4-methylpiperazin-1-yl)methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5S)-3,4-dibenzoyloxy-5-[5-[(4-methylpiperazin-1-yl)methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 15031093 |
| Molecular Formula | C36H36N4O9 |
| Molecular Weight | 668.70 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4-dibenzoyloxy-5-[5-[(4-methylpiperazin-1-yl)methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate |
| SMILES | CN1CCN(Cc2cn([C@H]3O[C@H](COC(=O)c4ccccc4)[C@@H](OC(=O)c4ccccc4)[C@@H]3OC(=O)c3ccccc3)c(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C36H36N4O9/c1-38-17-19-39(20-18-38)21-27-22-40(36(45)37-31(27)41)32-30(49-35(44)26-15-9-4-10-16-26)29(48-34(43)25-13-7-3-8-14-25)28(47-32)23-46-33(42)24-11-5-2-6-12-24/h2-16,22,28-30,32H,17-21,23H2,1H3,(H,37,41,45)/t28-,29-,30+,32+/m1/s1 |
| InChIKey | GMENKHBZBHLZJJ-ILARKSLGSA-N |
| XLogP | 2.49 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.70 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|