C29H50O5SSi2 — CID 11124620
ethyl 2-(benzenesulfinyl)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexyl]acetate (PubChem CID 11124620) has the molecular formula C29H50O5SSi2 and a molecular weight of 566.95 g/mol. Its IUPAC name is ethyl 2-(benzenesulfinyl)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexyl]acetate.
| Compound Name | ethyl 2-(benzenesulfinyl)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexyl]acetate |
|---|---|
| PubChem CID | 11124620 |
| Molecular Formula | C29H50O5SSi2 |
| Molecular Weight | 566.95 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | ethyl 2-(benzenesulfinyl)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexyl]acetate |
| SMILES | C=C1C(C(C(=O)OCC)S(=O)c2ccccc2)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H50O5SSi2/c1-13-32-27(30)26(35(31)23-17-15-14-16-18-23)24-19-22(33-36(9,10)28(3,4)5)20-25(21(24)2)34-37(11,12)29(6,7)8/h14-18,22,24-26H,2,13,19-20H2,1,3-12H3/t22-,24?,25+,26?,35?/m1/s1 |
| InChIKey | OOBIBYLHMJRSLR-ADFVOIGPSA-N |
| XLogP | 7.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.95 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|