C32H40O5SSi — CID 134847180
(4R)-6-[(2S)-1-(benzenesulfonyl)propan-2-yl]-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-one (PubChem CID 134847180) has the molecular formula C32H40O5SSi and a molecular weight of 564.82 g/mol. Its IUPAC name is (4R)-6-[(2S)-1-(benzenesulfonyl)propan-2-yl]-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-one.
| Compound Name | (4R)-6-[(2S)-1-(benzenesulfonyl)propan-2-yl]-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-one |
|---|---|
| PubChem CID | 134847180 |
| Molecular Formula | C32H40O5SSi |
| Molecular Weight | 564.82 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | (4R)-6-[(2S)-1-(benzenesulfonyl)propan-2-yl]-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-one |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)C1C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C32H40O5SSi/c1-25(24-38(34,35)27-14-8-5-9-15-27)30-22-26(23-31(33)37-30)20-21-36-39(32(2,3)4,28-16-10-6-11-17-28)29-18-12-7-13-19-29/h5-19,25-26,30H,20-24H2,1-4H3/t25-,26-,30?/m1/s1 |
| InChIKey | WXWWWHOTQJOINI-IRYNNBNGSA-N |
| XLogP | 5.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.82 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|