C32H40O5SSi — CID 11467175
(2R,6S)-5-(benzenesulfonyl)-8-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethyl-4-oxooctanal (PubChem CID 11467175) has the molecular formula C32H40O5SSi and a molecular weight of 564.82 g/mol. Its IUPAC name is (2R,6S)-5-(benzenesulfonyl)-8-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethyl-4-oxooctanal.
| Compound Name | (2R,6S)-5-(benzenesulfonyl)-8-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethyl-4-oxooctanal |
|---|---|
| PubChem CID | 11467175 |
| Molecular Formula | C32H40O5SSi |
| Molecular Weight | 564.82 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | (2R,6S)-5-(benzenesulfonyl)-8-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethyl-4-oxooctanal |
| SMILES | C[C@@H](C=O)CC(=O)C([C@@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H40O5SSi/c1-25(24-33)23-30(34)31(38(35,36)27-15-9-6-10-16-27)26(2)21-22-37-39(32(3,4)5,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h6-20,24-26,31H,21-23H2,1-5H3/t25-,26+,31?/m1/s1 |
| InChIKey | FYJVDSPQEWIXAO-FKCWEYQYSA-N |
| XLogP | 5.23 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.82 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|