C32H40O2SSi — CID 11455119
(4S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-4-methyl-3-phenylsulfanylcyclopentan-1-one (PubChem CID 11455119) has the molecular formula C32H40O2SSi and a molecular weight of 516.82 g/mol. Its IUPAC name is (4S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-4-methyl-3-phenylsulfanylcyclopentan-1-one.
| Compound Name | (4S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-4-methyl-3-phenylsulfanylcyclopentan-1-one |
|---|---|
| PubChem CID | 11455119 |
| Molecular Formula | C32H40O2SSi |
| Molecular Weight | 516.82 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | (4S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-4-methyl-3-phenylsulfanylcyclopentan-1-one |
| SMILES | C[C@H]1CC(=O)C([C@@H](C)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1Sc1ccccc1 |
| InChI | InChI=1S/C32H40O2SSi/c1-24(30-29(33)23-25(2)31(30)35-26-15-9-6-10-16-26)21-22-34-36(32(3,4)5,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-20,24-25,30-31H,21-23H2,1-5H3/t24-,25-,30?,31?/m0/s1 |
| InChIKey | RWYOUMUHQJGKEO-RAJFACKRSA-N |
| XLogP | 6.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.82 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|