C42H56O4SSi — CID 10628366
ethyl 5-[(1S,2R,3R)-3-[tert-butyl(diphenyl)silyl]oxy-5-oxo-2-[(E,1S)-1-phenylsulfanyloct-2-enyl]cyclopentyl]pentanoate (PubChem CID 10628366) has the molecular formula C42H56O4SSi and a molecular weight of 685.06 g/mol. Its IUPAC name is ethyl 5-[(1S,2R,3R)-3-[tert-butyl(diphenyl)silyl]oxy-5-oxo-2-[(E,1S)-1-phenylsulfanyloct-2-enyl]cyclopentyl]pentanoate.
| Compound Name | ethyl 5-[(1S,2R,3R)-3-[tert-butyl(diphenyl)silyl]oxy-5-oxo-2-[(E,1S)-1-phenylsulfanyloct-2-enyl]cyclopentyl]pentanoate |
|---|---|
| PubChem CID | 10628366 |
| Molecular Formula | C42H56O4SSi |
| Molecular Weight | 685.06 g/mol |
| Exact Mass | 684.37 |
| IUPAC Name | ethyl 5-[(1S,2R,3R)-3-[tert-butyl(diphenyl)silyl]oxy-5-oxo-2-[(E,1S)-1-phenylsulfanyloct-2-enyl]cyclopentyl]pentanoate |
| SMILES | CCCCC/C=C/[C@H](Sc1ccccc1)[C@@H]1[C@H](CCCCC(=O)OCC)C(=O)C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C42H56O4SSi/c1-6-8-9-10-20-30-39(47-33-23-14-11-15-24-33)41-36(29-21-22-31-40(44)45-7-2)37(43)32-38(41)46-48(42(3,4)5,34-25-16-12-17-26-34)35-27-18-13-19-28-35/h11-20,23-28,30,36,38-39,41H,6-10,21-22,29,31-32H2,1-5H3/b30-20+/t36-,38-,39+,41-/m1/s1 |
| InChIKey | GFUOVJMASYBTAO-QYQOCCNYSA-N |
| XLogP | 9.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.06 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|