C27H38O7S — CID 12050782
methyl 7-[(1R,2R,5S)-5-acetyloxy-2-(3-acetyloxy-4-phenylsulfanylbutyl)-3-oxocyclopentyl]heptanoate (PubChem CID 12050782) has the molecular formula C27H38O7S and a molecular weight of 506.66 g/mol. Its IUPAC name is methyl 7-[(1R,2R,5S)-5-acetyloxy-2-(3-acetyloxy-4-phenylsulfanylbutyl)-3-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,5S)-5-acetyloxy-2-(3-acetyloxy-4-phenylsulfanylbutyl)-3-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 12050782 |
| Molecular Formula | C27H38O7S |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | methyl 7-[(1R,2R,5S)-5-acetyloxy-2-(3-acetyloxy-4-phenylsulfanylbutyl)-3-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1[C@@H](OC(C)=O)CC(=O)[C@@H]1CCC(CSc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C27H38O7S/c1-19(28)33-21(18-35-22-11-7-6-8-12-22)15-16-23-24(26(17-25(23)30)34-20(2)29)13-9-4-5-10-14-27(31)32-3/h6-8,11-12,21,23-24,26H,4-5,9-10,13-18H2,1-3H3/t21?,23-,24-,26+/m1/s1 |
| InChIKey | WPQLJWJDCUGEGW-PAIDXFJGSA-N |
| XLogP | 5.14 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|