C23H33FO5S — CID 54394209
methyl 7-[(2R)-2-[4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3-hydroxy-5-oxocyclopentyl]heptanoate (PubChem CID 54394209) has the molecular formula C23H33FO5S and a molecular weight of 440.58 g/mol. Its IUPAC name is methyl 7-[(2R)-2-[4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3-hydroxy-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(2R)-2-[4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3-hydroxy-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 54394209 |
| Molecular Formula | C23H33FO5S |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | methyl 7-[(2R)-2-[4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3-hydroxy-5-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1C(=O)CC(O)[C@@H]1CCC(O)CSc1ccccc1F |
| InChI | InChI=1S/C23H33FO5S/c1-29-23(28)11-5-3-2-4-8-17-18(21(27)14-20(17)26)13-12-16(25)15-30-22-10-7-6-9-19(22)24/h6-7,9-10,16-18,21,25,27H,2-5,8,11-15H2,1H3/t16?,17?,18-,21?/m1/s1 |
| InChIKey | VIUARFKTNMLURM-IKQKDXEZSA-N |
| XLogP | 4.14 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|