C33H54O7SSi — CID 12050780
methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-(3-acetyloxy-4-phenylsulfanylbutyl)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]heptanoate (PubChem CID 12050780) has the molecular formula C33H54O7SSi and a molecular weight of 622.94 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-(3-acetyloxy-4-phenylsulfanylbutyl)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-(3-acetyloxy-4-phenylsulfanylbutyl)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 12050780 |
| Molecular Formula | C33H54O7SSi |
| Molecular Weight | 622.94 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-(3-acetyloxy-4-phenylsulfanylbutyl)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](CCC(CSc2ccccc2)OC(C)=O)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H54O7SSi/c1-24(34)38-26(23-41-27-16-12-11-13-17-27)20-21-29-28(18-14-9-10-15-19-32(36)37-6)30(39-25(2)35)22-31(29)40-42(7,8)33(3,4)5/h11-13,16-17,26,28-31H,9-10,14-15,18-23H2,1-8H3/t26?,28-,29-,30+,31-/m1/s1 |
| InChIKey | PSDZZJHCENYJTG-DQPWMDJKSA-N |
| XLogP | 7.96 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.94 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|