C22H32FO5S- — CID 59294021
7-[(1R,2R,3R,5S)-2-[(3R)-4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoate (PubChem CID 59294021) has the molecular formula C22H32FO5S- and a molecular weight of 427.56 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(3R)-4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoate.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(3R)-4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 59294021 |
| Molecular Formula | C22H32FO5S- |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(3R)-4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoate |
| SMILES | O=C([O-])CCCCCC[C@@H]1[C@@H](CC[C@@H](O)CSc2ccccc2F)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C22H33FO5S/c23-18-8-5-6-9-21(18)29-14-15(24)11-12-17-16(19(25)13-20(17)26)7-3-1-2-4-10-22(27)28/h5-6,8-9,15-17,19-20,24-26H,1-4,7,10-14H2,(H,27,28)/p-1/t15-,16-,17-,19+,20-/m1/s1 |
| InChIKey | QUKPIZUVCZLSFZ-RISVGRPXSA-M |
| XLogP | 2.51 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|