C23H35FO5S — CID 54455436
methyl 7-[(2R)-2-[4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoate (PubChem CID 54455436) has the molecular formula C23H35FO5S and a molecular weight of 442.59 g/mol. Its IUPAC name is methyl 7-[(2R)-2-[4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoate.
| Compound Name | methyl 7-[(2R)-2-[4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 54455436 |
| Molecular Formula | C23H35FO5S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | methyl 7-[(2R)-2-[4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1C(O)CC(O)[C@@H]1CCC(O)CSc1ccccc1F |
| InChI | InChI=1S/C23H35FO5S/c1-29-23(28)11-5-3-2-4-8-17-18(21(27)14-20(17)26)13-12-16(25)15-30-22-10-7-6-9-19(22)24/h6-7,9-10,16-18,20-21,25-27H,2-5,8,11-15H2,1H3/t16?,17?,18-,20?,21?/m1/s1 |
| InChIKey | WXWNDRIOPFNYII-KEKMYSLQSA-N |
| XLogP | 3.93 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|