C44H58O4SSi — CID 10580661
ethyl (Z)-7-[(1S,2R,3R)-3-[tert-butyl(diphenyl)silyl]oxy-5-oxo-2-[(E,1S)-1-phenylsulfanyloct-2-enyl]cyclopentyl]hept-5-enoate (PubChem CID 10580661) has the molecular formula C44H58O4SSi and a molecular weight of 711.10 g/mol. Its IUPAC name is ethyl (Z)-7-[(1S,2R,3R)-3-[tert-butyl(diphenyl)silyl]oxy-5-oxo-2-[(E,1S)-1-phenylsulfanyloct-2-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | ethyl (Z)-7-[(1S,2R,3R)-3-[tert-butyl(diphenyl)silyl]oxy-5-oxo-2-[(E,1S)-1-phenylsulfanyloct-2-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 10580661 |
| Molecular Formula | C44H58O4SSi |
| Molecular Weight | 711.10 g/mol |
| Exact Mass | 710.38 |
| IUPAC Name | ethyl (Z)-7-[(1S,2R,3R)-3-[tert-butyl(diphenyl)silyl]oxy-5-oxo-2-[(E,1S)-1-phenylsulfanyloct-2-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCC/C=C/[C@H](Sc1ccccc1)[C@@H]1[C@H](C/C=C\CCCC(=O)OCC)C(=O)C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C44H58O4SSi/c1-6-8-9-10-23-32-41(49-35-25-16-13-17-26-35)43-38(31-22-11-12-24-33-42(46)47-7-2)39(45)34-40(43)48-50(44(3,4)5,36-27-18-14-19-28-36)37-29-20-15-21-30-37/h11,13-23,25-30,32,38,40-41,43H,6-10,12,24,31,33-34H2,1-5H3/b22-11-,32-23+/t38-,40-,41+,43-/m1/s1 |
| InChIKey | CEPAGSUZICNCNU-QJGPBFKZSA-N |
| XLogP | 10.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.10 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|