C30H38O2S2Si — CID 134940380
S-phenyl (2S,3R)-5-phenyl-2-(phenylsulfanylmethyl)-3-triethylsilyloxypentanethioate (PubChem CID 134940380) has the molecular formula C30H38O2S2Si and a molecular weight of 522.85 g/mol. Its IUPAC name is S-phenyl (2S,3R)-5-phenyl-2-(phenylsulfanylmethyl)-3-triethylsilyloxypentanethioate.
| Compound Name | S-phenyl (2S,3R)-5-phenyl-2-(phenylsulfanylmethyl)-3-triethylsilyloxypentanethioate |
|---|---|
| PubChem CID | 134940380 |
| Molecular Formula | C30H38O2S2Si |
| Molecular Weight | 522.85 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | S-phenyl (2S,3R)-5-phenyl-2-(phenylsulfanylmethyl)-3-triethylsilyloxypentanethioate |
| SMILES | CC[Si](CC)(CC)O[C@H](CCc1ccccc1)[C@@H](CSc1ccccc1)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C30H38O2S2Si/c1-4-35(5-2,6-3)32-29(23-22-25-16-10-7-11-17-25)28(24-33-26-18-12-8-13-19-26)30(31)34-27-20-14-9-15-21-27/h7-21,28-29H,4-6,22-24H2,1-3H3/t28-,29-/m1/s1 |
| InChIKey | FVDSHUGMLSRYCT-FQLXRVMXSA-N |
| XLogP | 8.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.85 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|