C19H28O2S — CID 134874912
6-cyclohexyl-5-methoxy-6-phenylsulfanylhexan-3-one (PubChem CID 134874912) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is 6-cyclohexyl-5-methoxy-6-phenylsulfanylhexan-3-one.
| Compound Name | 6-cyclohexyl-5-methoxy-6-phenylsulfanylhexan-3-one |
|---|---|
| PubChem CID | 134874912 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 6-cyclohexyl-5-methoxy-6-phenylsulfanylhexan-3-one |
| SMILES | CCC(=O)CC(OC)C(Sc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C19H28O2S/c1-3-16(20)14-18(21-2)19(15-10-6-4-7-11-15)22-17-12-8-5-9-13-17/h5,8-9,12-13,15,18-19H,3-4,6-7,10-11,14H2,1-2H3 |
| InChIKey | ITLSBHCCLNEHEJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |