C21H26O3S — CID 3008264
6-(cyclohexyloxymethyl)-4-ethyl-5-phenylsulfanylcyclohex-4-ene-1,3-dione (PubChem CID 3008264) has the molecular formula C21H26O3S and a molecular weight of 358.50 g/mol. Its IUPAC name is 6-(cyclohexyloxymethyl)-4-ethyl-5-phenylsulfanylcyclohex-4-ene-1,3-dione.
| Compound Name | 6-(cyclohexyloxymethyl)-4-ethyl-5-phenylsulfanylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 3008264 |
| Molecular Formula | C21H26O3S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 6-(cyclohexyloxymethyl)-4-ethyl-5-phenylsulfanylcyclohex-4-ene-1,3-dione |
| SMILES | CCC1=C(Sc2ccccc2)C(COC2CCCCC2)C(=O)CC1=O |
| InChI | InChI=1S/C21H26O3S/c1-2-17-19(22)13-20(23)18(14-24-15-9-5-3-6-10-15)21(17)25-16-11-7-4-8-12-16/h4,7-8,11-12,15,18H,2-3,5-6,9-10,13-14H2,1H3 |
| InChIKey | QXXJYURFDVKOEE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|