C18H20O4S — CID 3008239
6-(2-hydroxyethoxymethyl)-5-phenylsulfanyl-4-prop-2-enylcyclohex-4-ene-1,3-dione (PubChem CID 3008239) has the molecular formula C18H20O4S and a molecular weight of 332.42 g/mol. Its IUPAC name is 6-(2-hydroxyethoxymethyl)-5-phenylsulfanyl-4-prop-2-enylcyclohex-4-ene-1,3-dione.
| Compound Name | 6-(2-hydroxyethoxymethyl)-5-phenylsulfanyl-4-prop-2-enylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 3008239 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 6-(2-hydroxyethoxymethyl)-5-phenylsulfanyl-4-prop-2-enylcyclohex-4-ene-1,3-dione |
| SMILES | C=CCC1=C(Sc2ccccc2)C(COCCO)C(=O)CC1=O |
| InChI | InChI=1S/C18H20O4S/c1-2-6-14-16(20)11-17(21)15(12-22-10-9-19)18(14)23-13-7-4-3-5-8-13/h2-5,7-8,15,19H,1,6,9-12H2 |
| InChIKey | VIDJALVVLOHQGN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|