C16H18O3S — CID 3008284
6-(ethoxymethyl)-4-methyl-5-phenylsulfanylcyclohex-4-ene-1,3-dione (PubChem CID 3008284) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is 6-(ethoxymethyl)-4-methyl-5-phenylsulfanylcyclohex-4-ene-1,3-dione.
| Compound Name | 6-(ethoxymethyl)-4-methyl-5-phenylsulfanylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 3008284 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 6-(ethoxymethyl)-4-methyl-5-phenylsulfanylcyclohex-4-ene-1,3-dione |
| SMILES | CCOCC1C(=O)CC(=O)C(C)=C1Sc1ccccc1 |
| InChI | InChI=1S/C16H18O3S/c1-3-19-10-13-15(18)9-14(17)11(2)16(13)20-12-7-5-4-6-8-12/h4-8,13H,3,9-10H2,1-2H3 |
| InChIKey | XMYZMHXHCPVANR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|