C17H20O3S — CID 3008286
6-(ethoxymethyl)-4-ethyl-5-phenylsulfanylcyclohex-4-ene-1,3-dione (PubChem CID 3008286) has the molecular formula C17H20O3S and a molecular weight of 304.41 g/mol. Its IUPAC name is 6-(ethoxymethyl)-4-ethyl-5-phenylsulfanylcyclohex-4-ene-1,3-dione.
| Compound Name | 6-(ethoxymethyl)-4-ethyl-5-phenylsulfanylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 3008286 |
| Molecular Formula | C17H20O3S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 6-(ethoxymethyl)-4-ethyl-5-phenylsulfanylcyclohex-4-ene-1,3-dione |
| SMILES | CCOCC1C(=O)CC(=O)C(CC)=C1Sc1ccccc1 |
| InChI | InChI=1S/C17H20O3S/c1-3-13-15(18)10-16(19)14(11-20-4-2)17(13)21-12-8-6-5-7-9-12/h5-9,14H,3-4,10-11H2,1-2H3 |
| InChIKey | SEGOZLFMJGGIQM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|