C24H32OSSi — CID 11825443
2-(3-phenyl-1-phenylsulfanyl-1-trimethylsilylpropyl)cyclohexan-1-one (PubChem CID 11825443) has the molecular formula C24H32OSSi and a molecular weight of 396.67 g/mol. Its IUPAC name is 2-(3-phenyl-1-phenylsulfanyl-1-trimethylsilylpropyl)cyclohexan-1-one.
| Compound Name | 2-(3-phenyl-1-phenylsulfanyl-1-trimethylsilylpropyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 11825443 |
| Molecular Formula | C24H32OSSi |
| Molecular Weight | 396.67 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-(3-phenyl-1-phenylsulfanyl-1-trimethylsilylpropyl)cyclohexan-1-one |
| SMILES | C[Si](C)(C)C(CCc1ccccc1)(Sc1ccccc1)C1CCCCC1=O |
| InChI | InChI=1S/C24H32OSSi/c1-27(2,3)24(22-16-10-11-17-23(22)25,26-21-14-8-5-9-15-21)19-18-20-12-6-4-7-13-20/h4-9,12-15,22H,10-11,16-19H2,1-3H3 |
| InChIKey | OOVBWPVRSVXQII-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.67 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|