C20H22OS2 — CID 13153796
3-[1,1-bis(phenylsulfanyl)ethyl]cyclohexan-1-one (PubChem CID 13153796) has the molecular formula C20H22OS2 and a molecular weight of 342.53 g/mol. Its IUPAC name is 3-[1,1-bis(phenylsulfanyl)ethyl]cyclohexan-1-one.
| Compound Name | 3-[1,1-bis(phenylsulfanyl)ethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 13153796 |
| Molecular Formula | C20H22OS2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-[1,1-bis(phenylsulfanyl)ethyl]cyclohexan-1-one |
| SMILES | CC(Sc1ccccc1)(Sc1ccccc1)C1CCCC(=O)C1 |
| InChI | InChI=1S/C20H22OS2/c1-20(16-9-8-10-17(21)15-16,22-18-11-4-2-5-12-18)23-19-13-6-3-7-14-19/h2-7,11-14,16H,8-10,15H2,1H3 |
| InChIKey | DHAICVFSPJOSSE-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|