C41H68O2SSi — CID 16757215
S-ethyl (3R,5R,7R,9S,11S,13S,15S)-16-[tert-butyl(diphenyl)silyl]oxy-3,5,7,9,11,13,15-heptamethylhexadecanethioate (PubChem CID 16757215) has the molecular formula C41H68O2SSi and a molecular weight of 653.15 g/mol. Its IUPAC name is S-ethyl (3R,5R,7R,9S,11S,13S,15S)-16-[tert-butyl(diphenyl)silyl]oxy-3,5,7,9,11,13,15-heptamethylhexadecanethioate.
| Compound Name | S-ethyl (3R,5R,7R,9S,11S,13S,15S)-16-[tert-butyl(diphenyl)silyl]oxy-3,5,7,9,11,13,15-heptamethylhexadecanethioate |
|---|---|
| PubChem CID | 16757215 |
| Molecular Formula | C41H68O2SSi |
| Molecular Weight | 653.15 g/mol |
| Exact Mass | 652.47 |
| IUPAC Name | S-ethyl (3R,5R,7R,9S,11S,13S,15S)-16-[tert-butyl(diphenyl)silyl]oxy-3,5,7,9,11,13,15-heptamethylhexadecanethioate |
| SMILES | CCSC(=O)C[C@H](C)C[C@H](C)C[C@H](C)C[C@H](C)C[C@H](C)C[C@H](C)C[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H68O2SSi/c1-12-44-40(42)29-36(7)27-34(5)25-32(3)23-31(2)24-33(4)26-35(6)28-37(8)30-43-45(41(9,10)11,38-19-15-13-16-20-38)39-21-17-14-18-22-39/h13-22,31-37H,12,23-30H2,1-11H3/t31-,32+,33-,34+,35-,36+,37-/m0/s1 |
| InChIKey | CAGNKRQAYTZZND-NDFPYJPBSA-N |
| XLogP | 11.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.15 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|