C25H44O2SSi — CID 134930458
S-tert-butyl (3S,4R)-4-methyl-5-phenyl-3-tri(propan-2-yl)silyloxypentanethioate (PubChem CID 134930458) has the molecular formula C25H44O2SSi and a molecular weight of 436.78 g/mol. Its IUPAC name is S-tert-butyl (3S,4R)-4-methyl-5-phenyl-3-tri(propan-2-yl)silyloxypentanethioate.
| Compound Name | S-tert-butyl (3S,4R)-4-methyl-5-phenyl-3-tri(propan-2-yl)silyloxypentanethioate |
|---|---|
| PubChem CID | 134930458 |
| Molecular Formula | C25H44O2SSi |
| Molecular Weight | 436.78 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | S-tert-butyl (3S,4R)-4-methyl-5-phenyl-3-tri(propan-2-yl)silyloxypentanethioate |
| SMILES | CC(C)[Si](O[C@@H](CC(=O)SC(C)(C)C)[C@H](C)Cc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H44O2SSi/c1-18(2)29(19(3)4,20(5)6)27-23(17-24(26)28-25(8,9)10)21(7)16-22-14-12-11-13-15-22/h11-15,18-21,23H,16-17H2,1-10H3/t21-,23+/m1/s1 |
| InChIKey | MGFLLDISVSSABO-GGAORHGYSA-N |
| XLogP | 7.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.78 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|