C27H44O3S3Si — CID 11763268
S-benzyl (2S)-2-[(4R,5S,6S)-2,2-ditert-butyl-6-[(1S)-1-(1,3-dithiolan-2-yl)ethyl]-5-methyl-1,3,2-dioxasilinan-4-yl]propanethioate (PubChem CID 11763268) has the molecular formula C27H44O3S3Si and a molecular weight of 540.93 g/mol. Its IUPAC name is S-benzyl (2S)-2-[(4R,5S,6S)-2,2-ditert-butyl-6-[(1S)-1-(1,3-dithiolan-2-yl)ethyl]-5-methyl-1,3,2-dioxasilinan-4-yl]propanethioate.
| Compound Name | S-benzyl (2S)-2-[(4R,5S,6S)-2,2-ditert-butyl-6-[(1S)-1-(1,3-dithiolan-2-yl)ethyl]-5-methyl-1,3,2-dioxasilinan-4-yl]propanethioate |
|---|---|
| PubChem CID | 11763268 |
| Molecular Formula | C27H44O3S3Si |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | S-benzyl (2S)-2-[(4R,5S,6S)-2,2-ditert-butyl-6-[(1S)-1-(1,3-dithiolan-2-yl)ethyl]-5-methyl-1,3,2-dioxasilinan-4-yl]propanethioate |
| SMILES | C[C@H]1[C@H]([C@H](C)C(=O)SCc2ccccc2)O[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]1[C@H](C)C1SCCS1 |
| InChI | InChI=1S/C27H44O3S3Si/c1-18-22(19(2)24(28)33-17-21-13-11-10-12-14-21)29-34(26(4,5)6,27(7,8)9)30-23(18)20(3)25-31-15-16-32-25/h10-14,18-20,22-23,25H,15-17H2,1-9H3/t18-,19-,20-,22+,23-/m0/s1 |
| InChIKey | ROHPBWWKYXELCX-JQZONJITSA-N |
| XLogP | 7.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|