C20H32O2S2Si — CID 10992953
(4aR,7aS)-6-benzylsulfanyl-2,2-ditert-butyl-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxasiline (PubChem CID 10992953) has the molecular formula C20H32O2S2Si and a molecular weight of 396.69 g/mol. Its IUPAC name is (4aR,7aS)-6-benzylsulfanyl-2,2-ditert-butyl-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxasiline.
| Compound Name | (4aR,7aS)-6-benzylsulfanyl-2,2-ditert-butyl-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxasiline |
|---|---|
| PubChem CID | 10992953 |
| Molecular Formula | C20H32O2S2Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (4aR,7aS)-6-benzylsulfanyl-2,2-ditert-butyl-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxasiline |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2SC(SCc3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C20H32O2S2Si/c1-19(2,3)25(20(4,5)6)21-13-17-16(22-25)12-18(24-17)23-14-15-10-8-7-9-11-15/h7-11,16-18H,12-14H2,1-6H3/t16-,17+,18?/m0/s1 |
| InChIKey | DLZCGHXHPSVBCI-MYFVLZFPSA-N |
| XLogP | 6.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|