C18H28O2S2Si — CID 134882381
(4R)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropyl]-1,3-oxathiolane-2-thione (PubChem CID 134882381) has the molecular formula C18H28O2S2Si and a molecular weight of 368.64 g/mol. Its IUPAC name is (4R)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropyl]-1,3-oxathiolane-2-thione.
| Compound Name | (4R)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropyl]-1,3-oxathiolane-2-thione |
|---|---|
| PubChem CID | 134882381 |
| Molecular Formula | C18H28O2S2Si |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (4R)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropyl]-1,3-oxathiolane-2-thione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CCc1ccccc1)[C@H]1COC(=S)S1 |
| InChI | InChI=1S/C18H28O2S2Si/c1-18(2,3)23(4,5)20-15(16-13-19-17(21)22-16)12-11-14-9-7-6-8-10-14/h6-10,15-16H,11-13H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | FDUPDUARQUILOO-HZPDHXFCSA-N |
| XLogP | 5.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|