C23H42O2S2Si2 — CID 134878851
[(2S,3S)-5-benzylsulfanyl-2-[tert-butyl(dimethyl)silyl]oxythiolan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134878851) has the molecular formula C23H42O2S2Si2 and a molecular weight of 470.89 g/mol. Its IUPAC name is [(2S,3S)-5-benzylsulfanyl-2-[tert-butyl(dimethyl)silyl]oxythiolan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S)-5-benzylsulfanyl-2-[tert-butyl(dimethyl)silyl]oxythiolan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134878851 |
| Molecular Formula | C23H42O2S2Si2 |
| Molecular Weight | 470.89 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | [(2S,3S)-5-benzylsulfanyl-2-[tert-butyl(dimethyl)silyl]oxythiolan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(SCc2ccccc2)S[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O2S2Si2/c1-22(2,3)28(7,8)24-19-16-20(26-17-18-14-12-11-13-15-18)27-21(19)25-29(9,10)23(4,5)6/h11-15,19-21H,16-17H2,1-10H3/t19-,20?,21-/m0/s1 |
| InChIKey | ANYWRSFFAJPIHU-YSTUSHMSSA-N |
| XLogP | 8.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.89 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|