C23H42OSSi — CID 154722620
tert-butyl-[(3R,4R,5R)-5-butylsulfanyl-4-methyl-1-phenylhexan-3-yl]oxy-dimethylsilane (PubChem CID 154722620) has the molecular formula C23H42OSSi and a molecular weight of 394.74 g/mol. Its IUPAC name is tert-butyl-[(3R,4R,5R)-5-butylsulfanyl-4-methyl-1-phenylhexan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4R,5R)-5-butylsulfanyl-4-methyl-1-phenylhexan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 154722620 |
| Molecular Formula | C23H42OSSi |
| Molecular Weight | 394.74 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | tert-butyl-[(3R,4R,5R)-5-butylsulfanyl-4-methyl-1-phenylhexan-3-yl]oxy-dimethylsilane |
| SMILES | CCCCS[C@H](C)[C@H](C)[C@@H](CCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42OSSi/c1-9-10-18-25-20(3)19(2)22(24-26(7,8)23(4,5)6)17-16-21-14-12-11-13-15-21/h11-15,19-20,22H,9-10,16-18H2,1-8H3/t19-,20+,22+/m0/s1 |
| InChIKey | WASHQJHOCYXTHU-TUNNFDKTSA-N |
| XLogP | 7.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.74 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|