C17H28OSSi — CID 134928109
tert-butyl-dimethyl-[(1R)-3-phenyl-1-[(2S)-thiiran-2-yl]propoxy]silane (PubChem CID 134928109) has the molecular formula C17H28OSSi and a molecular weight of 308.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R)-3-phenyl-1-[(2S)-thiiran-2-yl]propoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1R)-3-phenyl-1-[(2S)-thiiran-2-yl]propoxy]silane |
|---|---|
| PubChem CID | 134928109 |
| Molecular Formula | C17H28OSSi |
| Molecular Weight | 308.56 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | tert-butyl-dimethyl-[(1R)-3-phenyl-1-[(2S)-thiiran-2-yl]propoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CCc1ccccc1)[C@H]1CS1 |
| InChI | InChI=1S/C17H28OSSi/c1-17(2,3)20(4,5)18-15(16-13-19-16)12-11-14-9-7-6-8-10-14/h6-10,15-16H,11-13H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | WUJFQBOCAIAAEU-HZPDHXFCSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|