C25H44O3S2Si2 — CID 25268283
[(4aR,6S,7R,7aS)-2,2-ditert-butyl-6-phenylsulfanyl-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxasilin-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 25268283) has the molecular formula C25H44O3S2Si2 and a molecular weight of 512.93 g/mol. Its IUPAC name is [(4aR,6S,7R,7aS)-2,2-ditert-butyl-6-phenylsulfanyl-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxasilin-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aR,6S,7R,7aS)-2,2-ditert-butyl-6-phenylsulfanyl-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxasilin-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 25268283 |
| Molecular Formula | C25H44O3S2Si2 |
| Molecular Weight | 512.93 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | [(4aR,6S,7R,7aS)-2,2-ditert-butyl-6-phenylsulfanyl-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxasilin-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](Sc2ccccc2)S[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]12 |
| InChI | InChI=1S/C25H44O3S2Si2/c1-23(2,3)31(10,11)27-21-20-19(30-22(21)29-18-15-13-12-14-16-18)17-26-32(28-20,24(4,5)6)25(7,8)9/h12-16,19-22H,17H2,1-11H3/t19-,20-,21-,22-/m1/s1 |
| InChIKey | ACQHRMKJGFOVCX-GXRSIYKFSA-N |
| XLogP | 8.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.93 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|